C16H20ClFN4O — CID 119487860
[1-(2-fluorophenyl)pyrazol-3-yl]-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119487860) has the molecular formula C16H20ClFN4O and a molecular weight of 338.81 g/mol. Its IUPAC name is [1-(2-fluorophenyl)pyrazol-3-yl]-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | [1-(2-fluorophenyl)pyrazol-3-yl]-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119487860 |
| Molecular Formula | C16H20ClFN4O |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [1-(2-fluorophenyl)pyrazol-3-yl]-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2ccn(-c3ccccc3F)n2)C1.Cl |
| InChI | InChI=1S/C16H19FN4O.ClH/c1-18-12-5-4-9-20(11-12)16(22)14-8-10-21(19-14)15-7-3-2-6-13(15)17;/h2-3,6-8,10,12,18H,4-5,9,11H2,1H3;1H |
| InChIKey | DUTAZFNDWKFPHH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |