C16H31N3O2 — CID 119487968
4-[3-(methylamino)piperidin-1-yl]-4-oxo-N,N-dipropylbutanamide (PubChem CID 119487968) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-[3-(methylamino)piperidin-1-yl]-4-oxo-N,N-dipropylbutanamide.
| Compound Name | 4-[3-(methylamino)piperidin-1-yl]-4-oxo-N,N-dipropylbutanamide |
|---|---|
| PubChem CID | 119487968 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 4-[3-(methylamino)piperidin-1-yl]-4-oxo-N,N-dipropylbutanamide |
| SMILES | CCCN(CCC)C(=O)CCC(=O)N1CCCC(NC)C1 |
| InChI | InChI=1S/C16H31N3O2/c1-4-10-18(11-5-2)15(20)8-9-16(21)19-12-6-7-14(13-19)17-3/h14,17H,4-13H2,1-3H3 |
| InChIKey | UBOUKHJPWKFOHI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |