C17H24N4O2 — CID 119490576
1-methyl-4-[3-(methylamino)piperidine-1-carbonyl]-5-pyridin-3-ylpyrrolidin-2-one (PubChem CID 119490576) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-methyl-4-[3-(methylamino)piperidine-1-carbonyl]-5-pyridin-3-ylpyrrolidin-2-one.
| Compound Name | 1-methyl-4-[3-(methylamino)piperidine-1-carbonyl]-5-pyridin-3-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 119490576 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-methyl-4-[3-(methylamino)piperidine-1-carbonyl]-5-pyridin-3-ylpyrrolidin-2-one |
| SMILES | CNC1CCCN(C(=O)C2CC(=O)N(C)C2c2cccnc2)C1 |
| InChI | InChI=1S/C17H24N4O2/c1-18-13-6-4-8-21(11-13)17(23)14-9-15(22)20(2)16(14)12-5-3-7-19-10-12/h3,5,7,10,13-14,16,18H,4,6,8-9,11H2,1-2H3 |
| InChIKey | QIXHHYWNIHYUBC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |