C19H28ClN3O2 — CID 119490707
1-methyl-5-[3-(methylamino)piperidine-1-carbonyl]-6-phenylpiperidin-2-one;hydrochloride (PubChem CID 119490707) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is 1-methyl-5-[3-(methylamino)piperidine-1-carbonyl]-6-phenylpiperidin-2-one;hydrochloride.
| Compound Name | 1-methyl-5-[3-(methylamino)piperidine-1-carbonyl]-6-phenylpiperidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119490707 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-methyl-5-[3-(methylamino)piperidine-1-carbonyl]-6-phenylpiperidin-2-one;hydrochloride |
| SMILES | CNC1CCCN(C(=O)C2CCC(=O)N(C)C2c2ccccc2)C1.Cl |
| InChI | InChI=1S/C19H27N3O2.ClH/c1-20-15-9-6-12-22(13-15)19(24)16-10-11-17(23)21(2)18(16)14-7-4-3-5-8-14;/h3-5,7-8,15-16,18,20H,6,9-13H2,1-2H3;1H |
| InChIKey | UNJGWCHUSUVHMF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |