C29H27ClN4O3 — CID 1194929
3-chloro-1-(2-phenylethyl)-4-[4-(4-phenylpiperazine-1-carbonyl)anilino]pyrrole-2,5-dione (PubChem CID 1194929) has the molecular formula C29H27ClN4O3 and a molecular weight of 515.01 g/mol. Its IUPAC name is 3-chloro-1-(2-phenylethyl)-4-[4-(4-phenylpiperazine-1-carbonyl)anilino]pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(2-phenylethyl)-4-[4-(4-phenylpiperazine-1-carbonyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1194929 |
| Molecular Formula | C29H27ClN4O3 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 3-chloro-1-(2-phenylethyl)-4-[4-(4-phenylpiperazine-1-carbonyl)anilino]pyrrole-2,5-dione |
| SMILES | O=C(c1ccc(NC2=C(Cl)C(=O)N(CCc3ccccc3)C2=O)cc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H27ClN4O3/c30-25-26(29(37)34(28(25)36)16-15-21-7-3-1-4-8-21)31-23-13-11-22(12-14-23)27(35)33-19-17-32(18-20-33)24-9-5-2-6-10-24/h1-14,31H,15-20H2 |
| InChIKey | QNQCCAVECCRCMD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|