C13H19ClN4O2 — CID 119493800
5-[3-(methylamino)piperidine-1-carbonyl]pyridine-2-carboxamide;hydrochloride (PubChem CID 119493800) has the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-[3-(methylamino)piperidine-1-carbonyl]pyridine-2-carboxamide;hydrochloride.
| Compound Name | 5-[3-(methylamino)piperidine-1-carbonyl]pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119493800 |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-[3-(methylamino)piperidine-1-carbonyl]pyridine-2-carboxamide;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2ccc(C(N)=O)nc2)C1.Cl |
| InChI | InChI=1S/C13H18N4O2.ClH/c1-15-10-3-2-6-17(8-10)13(19)9-4-5-11(12(14)18)16-7-9;/h4-5,7,10,15H,2-3,6,8H2,1H3,(H2,14,18);1H |
| InChIKey | OJNPGQQKUBBJIO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |