C16H18N6O3 — CID 11949605
6-amino-9-benzyl-N-(2-methoxyethyl)-8-oxo-7H-purine-2-carboxamide (PubChem CID 11949605) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 6-amino-9-benzyl-N-(2-methoxyethyl)-8-oxo-7H-purine-2-carboxamide.
| Compound Name | 6-amino-9-benzyl-N-(2-methoxyethyl)-8-oxo-7H-purine-2-carboxamide |
|---|---|
| PubChem CID | 11949605 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 6-amino-9-benzyl-N-(2-methoxyethyl)-8-oxo-7H-purine-2-carboxamide |
| SMILES | COCCNC(=O)c1nc(N)c2[nH]c(=O)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C16H18N6O3/c1-25-8-7-18-15(23)13-20-12(17)11-14(21-13)22(16(24)19-11)9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,18,23)(H,19,24)(H2,17,20,21) |
| InChIKey | JBMXBXFCHWLZSC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|