C15H25ClN2O3 — CID 119497040
N-(3-aminobutyl)-2-[(3-methoxyphenyl)methoxy]propanamide;hydrochloride (PubChem CID 119497040) has the molecular formula C15H25ClN2O3 and a molecular weight of 316.83 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-[(3-methoxyphenyl)methoxy]propanamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-2-[(3-methoxyphenyl)methoxy]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119497040 |
| Molecular Formula | C15H25ClN2O3 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-(3-aminobutyl)-2-[(3-methoxyphenyl)methoxy]propanamide;hydrochloride |
| SMILES | COc1cccc(COC(C)C(=O)NCCC(C)N)c1.Cl |
| InChI | InChI=1S/C15H24N2O3.ClH/c1-11(16)7-8-17-15(18)12(2)20-10-13-5-4-6-14(9-13)19-3;/h4-6,9,11-12H,7-8,10,16H2,1-3H3,(H,17,18);1H |
| InChIKey | QUUSGCYXKMXGJX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |