C35H43AsN4O7 — CID 11949825
methyl 5-(2,2,3,3,7,7,8,8-octamethyl-1,4,6,9-tetraoxa-5λ5-arsaspiro[4.4]nonan-5-yl)-6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 11949825) has the molecular formula C35H43AsN4O7 and a molecular weight of 706.67 g/mol. Its IUPAC name is methyl 5-(2,2,3,3,7,7,8,8-octamethyl-1,4,6,9-tetraoxa-5λ5-arsaspiro[4.4]nonan-5-yl)-6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | methyl 5-(2,2,3,3,7,7,8,8-octamethyl-1,4,6,9-tetraoxa-5λ5-arsaspiro[4.4]nonan-5-yl)-6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 11949825 |
| Molecular Formula | C35H43AsN4O7 |
| Molecular Weight | 706.67 g/mol |
| Exact Mass | 706.23 |
| IUPAC Name | methyl 5-(2,2,3,3,7,7,8,8-octamethyl-1,4,6,9-tetraoxa-5λ5-arsaspiro[4.4]nonan-5-yl)-6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c3c(c([As]45(OC(C)(C)C(C)(C)O4)OC(C)(C)C(C)(C)O5)cc2[nH]1)N(C(=O)c1cc2c4c(ccc2[nH]1)NCC4)CC3 |
| InChI | InChI=1S/C35H43AsN4O7/c1-32(2)33(3,4)45-36(44-32,46-34(5,6)35(7,8)47-36)23-18-26-22(17-28(39-26)31(42)43-9)20-13-15-40(29(20)23)30(41)27-16-21-19-12-14-37-24(19)10-11-25(21)38-27/h10-11,16-18,37-39H,12-15H2,1-9H3 |
| InChIKey | VRFYCZGXYDBFHM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|