C33H26F4N4O5 — CID 15480272
(2,3,5,6-tetrafluorophenyl) 6-[6-[(2-methylpropan-2-yl)oxycarbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 15480272) has the molecular formula C33H26F4N4O5 and a molecular weight of 634.59 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 6-[6-[(2-methylpropan-2-yl)oxycarbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 6-[6-[(2-methylpropan-2-yl)oxycarbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 15480272 |
| Molecular Formula | C33H26F4N4O5 |
| Molecular Weight | 634.59 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 6-[6-[(2-methylpropan-2-yl)oxycarbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c1ccc1[nH]c(C(=O)N3CCc4c3ccc3[nH]c(C(=O)Oc5c(F)c(F)cc(F)c5F)cc43)cc21 |
| InChI | InChI=1S/C33H26F4N4O5/c1-33(2,3)46-32(44)41-11-9-16-17-12-23(38-21(17)5-7-26(16)41)30(42)40-10-8-15-18-13-24(39-22(18)4-6-25(15)40)31(43)45-29-27(36)19(34)14-20(35)28(29)37/h4-7,12-14,38-39H,8-11H2,1-3H3 |
| InChIKey | ILTREXQHTZSCQU-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.59 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|