C29H19F4N5O4 — CID 15480265
(2,3,5,6-tetrafluorophenyl) 6-(6-carbamoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 15480265) has the molecular formula C29H19F4N5O4 and a molecular weight of 577.49 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 6-(6-carbamoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 6-(6-carbamoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 15480265 |
| Molecular Formula | C29H19F4N5O4 |
| Molecular Weight | 577.49 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 6-(6-carbamoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | NC(=O)N1CCc2c1ccc1[nH]c(C(=O)N3CCc4c3ccc3[nH]c(C(=O)Oc5c(F)c(F)cc(F)c5F)cc43)cc21 |
| InChI | InChI=1S/C29H19F4N5O4/c30-16-11-17(31)25(33)26(24(16)32)42-28(40)21-10-15-12-5-7-37(22(12)3-1-19(15)36-21)27(39)20-9-14-13-6-8-38(29(34)41)23(13)4-2-18(14)35-20/h1-4,9-11,35-36H,5-8H2,(H2,34,41) |
| InChIKey | HEJJDVPJMXEALD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|