C34H26F4N4O5 — CID 15334256
(2,3,5,6-tetrafluorophenyl) 4-[2-[(1R,12S)-3,5-dimethyl-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]-4-oxobutanoate (PubChem CID 15334256) has the molecular formula C34H26F4N4O5 and a molecular weight of 646.60 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 4-[2-[(1R,12S)-3,5-dimethyl-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]-4-oxobutanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 4-[2-[(1R,12S)-3,5-dimethyl-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 15334256 |
| Molecular Formula | C34H26F4N4O5 |
| Molecular Weight | 646.60 g/mol |
| Exact Mass | 646.18 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 4-[2-[(1R,12S)-3,5-dimethyl-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]-4-oxobutanoate |
| SMILES | Cc1cn(C)c2c1[C@@]13C[C@@H]1CN(C(=O)c1cc4c5c(ccc4[nH]1)N(C(=O)CCC(=O)Oc1c(F)c(F)cc(F)c1F)CC5)C3=CC2=O |
| InChI | InChI=1S/C34H26F4N4O5/c1-15-13-40(2)31-24(43)11-25-34(28(15)31)12-16(34)14-42(25)33(46)22-9-18-17-7-8-41(23(17)4-3-21(18)39-22)26(44)5-6-27(45)47-32-29(37)19(35)10-20(36)30(32)38/h3-4,9-11,13,16,39H,5-8,12,14H2,1-2H3/t16-,34+/m1/s1 |
| InChIKey | XPNKIPPDBLIBAB-RZCFMFBHSA-N |
| XLogP | 5.14 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|