C14H16N2O — CID 54141257
1-(6-ethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl)ethanone (PubChem CID 54141257) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-(6-ethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl)ethanone.
| Compound Name | 1-(6-ethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 54141257 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-(6-ethyl-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl)ethanone |
| SMILES | CCN1CCc2c1ccc1[nH]c(C(C)=O)cc21 |
| InChI | InChI=1S/C14H16N2O/c1-3-16-7-6-10-11-8-13(9(2)17)15-12(11)4-5-14(10)16/h4-5,8,15H,3,6-7H2,1-2H3 |
| InChIKey | OBGPADCSXGAFQP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |