C21H17N5O2S — CID 159555973
1-[6-[2-(methyldiazenyl)-1,3-benzothiazole-6-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]ethanone (PubChem CID 159555973) has the molecular formula C21H17N5O2S and a molecular weight of 403.47 g/mol. Its IUPAC name is 1-[6-[2-(methyldiazenyl)-1,3-benzothiazole-6-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]ethanone.
| Compound Name | 1-[6-[2-(methyldiazenyl)-1,3-benzothiazole-6-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 159555973 |
| Molecular Formula | C21H17N5O2S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 1-[6-[2-(methyldiazenyl)-1,3-benzothiazole-6-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]ethanone |
| SMILES | C/N=N/c1nc2ccc(C(=O)N3CCc4c3ccc3[nH]c(C(C)=O)cc43)cc2s1 |
| InChI | InChI=1S/C21H17N5O2S/c1-11(27)17-10-14-13-7-8-26(18(13)6-5-15(14)23-17)20(28)12-3-4-16-19(9-12)29-21(24-16)25-22-2/h3-6,9-10,23H,7-8H2,1-2H3/b25-22+ |
| InChIKey | KSCKALKVLRUBRF-YYDJUVGSSA-N |
| XLogP | 4.90 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|