C37H35N7O4 — CID 145169161
2-formyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carboxamide;1-[6-(6-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]propan-1-one (PubChem CID 145169161) has the molecular formula C37H35N7O4 and a molecular weight of 641.73 g/mol. Its IUPAC name is 2-formyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carboxamide;1-[6-(6-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]propan-1-one.
| Compound Name | 2-formyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carboxamide;1-[6-(6-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 145169161 |
| Molecular Formula | C37H35N7O4 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 2-formyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carboxamide;1-[6-(6-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-2-yl]propan-1-one |
| SMILES | CCC(=O)c1cc2c3c(ccc2[nH]1)N(C(=O)c1cc2c4c(ccc2[nH]1)N(C)CC4)CC3.NC(=O)N1CCc2c1ccc1[nH]c(C=O)cc21 |
| InChI | InChI=1S/C25H24N4O2.C12H11N3O2/c1-3-24(30)20-12-16-15-9-11-29(23(15)7-5-18(16)26-20)25(31)21-13-17-14-8-10-28(2)22(14)6-4-19(17)27-21;13-12(17)15-4-3-8-9-5-7(6-16)14-10(9)1-2-11(8)15/h4-7,12-13,26-27H,3,8-11H2,1-2H3;1-2,5-6,14H,3-4H2,(H2,13,17) |
| InChIKey | WNVCLAIOSSWZBK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|