C23H20F4N2O3 — CID 22890109
(2,3,5,6-tetrafluorophenyl) 6-(3,3-dimethylbutanoyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 22890109) has the molecular formula C23H20F4N2O3 and a molecular weight of 448.42 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 6-(3,3-dimethylbutanoyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 6-(3,3-dimethylbutanoyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 22890109 |
| Molecular Formula | C23H20F4N2O3 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 6-(3,3-dimethylbutanoyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | CC(C)(C)CC(=O)N1CCc2c1ccc1[nH]c(C(=O)Oc3c(F)c(F)cc(F)c3F)cc21 |
| InChI | InChI=1S/C23H20F4N2O3/c1-23(2,3)10-18(30)29-7-6-11-12-8-16(28-15(12)4-5-17(11)29)22(31)32-21-19(26)13(24)9-14(25)20(21)27/h4-5,8-9,28H,6-7,10H2,1-3H3 |
| InChIKey | JWCUZVPFWNXDNT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|