C27H29NO2 — CID 166626466
[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] 1H-indole-2-carboxylate (PubChem CID 166626466) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is [4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] 1H-indole-2-carboxylate.
| Compound Name | [4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 166626466 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | [4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] 1H-indole-2-carboxylate |
| SMILES | C=C[C@@](C)(/C=C/c1ccc(OC(=O)c2cc3ccccc3[nH]2)cc1)CCC=C(C)C |
| InChI | InChI=1S/C27H29NO2/c1-5-27(4,17-8-9-20(2)3)18-16-21-12-14-23(15-13-21)30-26(29)25-19-22-10-6-7-11-24(22)28-25/h5-7,9-16,18-19,28H,1,8,17H2,2-4H3/b18-16+/t27-/m1/s1 |
| InChIKey | OHYPVMXKTHVEMQ-DRTHVRHMSA-N |
| XLogP | 7.34 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|