C27H30ClN3O — CID 166627864
1-(4-chlorophenyl)-4-[[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]methyl]triazole (PubChem CID 166627864) has the molecular formula C27H30ClN3O and a molecular weight of 448.01 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]methyl]triazole.
| Compound Name | 1-(4-chlorophenyl)-4-[[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]methyl]triazole |
|---|---|
| PubChem CID | 166627864 |
| Molecular Formula | C27H30ClN3O |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]methyl]triazole |
| SMILES | C=C[C@@](C)(/C=C/c1ccc(OCc2cn(-c3ccc(Cl)cc3)nn2)cc1)CCC=C(C)C |
| InChI | InChI=1S/C27H30ClN3O/c1-5-27(4,17-6-7-21(2)3)18-16-22-8-14-26(15-9-22)32-20-24-19-31(30-29-24)25-12-10-23(28)11-13-25/h5,7-16,18-19H,1,6,17,20H2,2-4H3/b18-16+/t27-/m1/s1 |
| InChIKey | WUUWBWVDUFLSQC-DRTHVRHMSA-N |
| XLogP | 7.45 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|