C32H53NO — CID 170060237
N-[4-[4-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]butyl]decan-1-amine (PubChem CID 170060237) has the molecular formula C32H53NO and a molecular weight of 467.78 g/mol. Its IUPAC name is N-[4-[4-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]butyl]decan-1-amine.
| Compound Name | N-[4-[4-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]butyl]decan-1-amine |
|---|---|
| PubChem CID | 170060237 |
| Molecular Formula | C32H53NO |
| Molecular Weight | 467.78 g/mol |
| Exact Mass | 467.41 |
| IUPAC Name | N-[4-[4-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]butyl]decan-1-amine |
| SMILES | C=CC(C)(/C=C/c1ccc(OCCCCNCCCCCCCCCC)cc1)CCC=C(C)C |
| InChI | InChI=1S/C32H53NO/c1-6-8-9-10-11-12-13-14-26-33-27-15-16-28-34-31-21-19-30(20-22-31)23-25-32(5,7-2)24-17-18-29(3)4/h7,18-23,25,33H,2,6,8-17,24,26-28H2,1,3-5H3/b25-23+ |
| InChIKey | YEJSQKSFBVASIX-WJTDDFOZSA-N |
| XLogP | 9.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.78 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|