C22H27FN2O4 — CID 11949888
5-(4-fluorophenyl)-N-[[(1S,2S)-2-hydroxycyclohexyl]methyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide (PubChem CID 11949888) has the molecular formula C22H27FN2O4 and a molecular weight of 402.47 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[[(1S,2S)-2-hydroxycyclohexyl]methyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[[(1S,2S)-2-hydroxycyclohexyl]methyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11949888 |
| Molecular Formula | C22H27FN2O4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[[(1S,2S)-2-hydroxycyclohexyl]methyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide |
| SMILES | COCCOc1ncc(C(=O)NC[C@@H]2CCCC[C@@H]2O)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H27FN2O4/c1-28-10-11-29-22-19(15-6-8-18(23)9-7-15)12-17(14-25-22)21(27)24-13-16-4-2-3-5-20(16)26/h6-9,12,14,16,20,26H,2-5,10-11,13H2,1H3,(H,24,27)/t16-,20-/m0/s1 |
| InChIKey | RROOXCIKLSGTEX-JXFKEZNVSA-N |
| XLogP | 3.19 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|