C16H24N2O — CID 119500317
N-[2-(methylamino)ethyl]-2-(4-propan-2-ylphenyl)cyclopropane-1-carboxamide (PubChem CID 119500317) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-2-(4-propan-2-ylphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[2-(methylamino)ethyl]-2-(4-propan-2-ylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119500317 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-[2-(methylamino)ethyl]-2-(4-propan-2-ylphenyl)cyclopropane-1-carboxamide |
| SMILES | CNCCNC(=O)C1CC1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O/c1-11(2)12-4-6-13(7-5-12)14-10-15(14)16(19)18-9-8-17-3/h4-7,11,14-15,17H,8-10H2,1-3H3,(H,18,19) |
| InChIKey | UQOCALVQFLNXCG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|