C8H16N2O — CID 62657204
2-methyl-N-[2-(methylamino)ethyl]cyclopropane-1-carboxamide (PubChem CID 62657204) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-methyl-N-[2-(methylamino)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 2-methyl-N-[2-(methylamino)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 62657204 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-methyl-N-[2-(methylamino)ethyl]cyclopropane-1-carboxamide |
| SMILES | CNCCNC(=O)C1CC1C |
| InChI | InChI=1S/C8H16N2O/c1-6-5-7(6)8(11)10-4-3-9-2/h6-7,9H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | MVALWKJVJIYLOX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|