C9H18N2O3S — CID 94816215
trans-(1R,2R)-N-[2-(ethylsulfonylamino)ethyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 94816215) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is trans-(1R,2R)-N-[2-(ethylsulfonylamino)ethyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[2-(ethylsulfonylamino)ethyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94816215 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | trans-(1R,2R)-N-[2-(ethylsulfonylamino)ethyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | CCS(=O)(=O)NCCNC(=O)[C@@H]1C[C@H]1C |
| InChI | InChI=1S/C9H18N2O3S/c1-3-15(13,14)11-5-4-10-9(12)8-6-7(8)2/h7-8,11H,3-6H2,1-2H3,(H,10,12)/t7-,8-/m1/s1 |
| InChIKey | KVBARUHPCPQYMW-HTQZYQBOSA-N |
| XLogP | -0.30 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|