C9H16N2O5S — CID 120976004
2-[2-(methanesulfonamido)ethylcarbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120976004) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)ethylcarbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[2-(methanesulfonamido)ethylcarbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120976004 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-[2-(methanesulfonamido)ethylcarbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | CS(=O)(=O)NCCNC(=O)C1CCC1C(=O)O |
| InChI | InChI=1S/C9H16N2O5S/c1-17(15,16)11-5-4-10-8(12)6-2-3-7(6)9(13)14/h6-7,11H,2-5H2,1H3,(H,10,12)(H,13,14) |
| InChIKey | AUVCPWUJNJLEPH-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|