C10H17NO — CID 115627883
2-methyl-N-[(E)-pent-3-enyl]cyclopropane-1-carboxamide (PubChem CID 115627883) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-methyl-N-[(E)-pent-3-enyl]cyclopropane-1-carboxamide.
| Compound Name | 2-methyl-N-[(E)-pent-3-enyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 115627883 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-methyl-N-[(E)-pent-3-enyl]cyclopropane-1-carboxamide |
| SMILES | C/C=C/CCNC(=O)C1CC1C |
| InChI | InChI=1S/C10H17NO/c1-3-4-5-6-11-10(12)9-7-8(9)2/h3-4,8-9H,5-7H2,1-2H3,(H,11,12)/b4-3+ |
| InChIKey | NDQLMPIKTRDAJK-ONEGZZNKSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|