C18H22N2O3S — CID 95157526
trans-(1R,2R)-N-[2-(ethylsulfonylamino)ethyl]-2-naphthalen-1-ylcyclopropane-1-carboxamide (PubChem CID 95157526) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is trans-(1R,2R)-N-[2-(ethylsulfonylamino)ethyl]-2-naphthalen-1-ylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[2-(ethylsulfonylamino)ethyl]-2-naphthalen-1-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95157526 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | trans-(1R,2R)-N-[2-(ethylsulfonylamino)ethyl]-2-naphthalen-1-ylcyclopropane-1-carboxamide |
| SMILES | CCS(=O)(=O)NCCNC(=O)[C@@H]1C[C@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C18H22N2O3S/c1-2-24(22,23)20-11-10-19-18(21)17-12-16(17)15-9-5-7-13-6-3-4-8-14(13)15/h3-9,16-17,20H,2,10-12H2,1H3,(H,19,21)/t16-,17+/m0/s1 |
| InChIKey | QRYHVWCNRZPKGZ-DLBZAZTESA-N |
| XLogP | 2.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|