C14H19Cl2N3O2 — CID 119502119
N-[2-(methylamino)ethyl]-5-(4-methylphenyl)-1,3-oxazole-4-carboxamide;dihydrochloride (PubChem CID 119502119) has the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.23 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-5-(4-methylphenyl)-1,3-oxazole-4-carboxamide;dihydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-5-(4-methylphenyl)-1,3-oxazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119502119 |
| Molecular Formula | C14H19Cl2N3O2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-[2-(methylamino)ethyl]-5-(4-methylphenyl)-1,3-oxazole-4-carboxamide;dihydrochloride |
| SMILES | CNCCNC(=O)c1ncoc1-c1ccc(C)cc1.Cl.Cl |
| InChI | InChI=1S/C14H17N3O2.2ClH/c1-10-3-5-11(6-4-10)13-12(17-9-19-13)14(18)16-8-7-15-2;;/h3-6,9,15H,7-8H2,1-2H3,(H,16,18);2*1H |
| InChIKey | WZRBSDNIGVGXBR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|