About N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride
N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride (PubChem CID 19768719) has the molecular formula C12H12Cl3N3O2
and a molecular weight of 336.61 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride |
| PubChem CID | 19768719 |
| Molecular Formula | C12H12Cl3N3O2 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1ncoc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3O2.ClH/c13-8-2-1-7(5-9(8)14)11-10(17-6-19-11)12(18)16-4-3-15;/h1-2,5-6H,3-4,15H2,(H,16,18);1H |
| InChIKey | NABZVFMPHKZZMH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride?
The IUPAC name of N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride (CID 19768719) is N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride.
What is the SMILES notation for N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride?
The canonical SMILES for N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride is Cl.NCCNC(=O)c1ncoc1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride?
The InChIKey is NABZVFMPHKZZMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2N3O2.ClH/c13-8-2-1-7(5-9(8)14)11-10(17-6-19-11)12(18)16-4-3-15;/h1-2,5-6H,3-4,15H2,(H,16,18);1H.
What are the key properties of N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride?
N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride has a molecular weight of 336.61 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole-4-carboxamide;hydrochloride is sourced from PubChem (CID 19768719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).