C21H29FN2O — CID 11950308
N-[1-(2-bicyclo[2.2.1]heptanylmethyl)piperidin-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 11950308) has the molecular formula C21H29FN2O and a molecular weight of 344.47 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanylmethyl)piperidin-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanylmethyl)piperidin-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 11950308 |
| Molecular Formula | C21H29FN2O |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanylmethyl)piperidin-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CC(=O)N(c1ccc(F)cc1)C1CCN(CC2CC3CCC2C3)CC1 |
| InChI | InChI=1S/C21H29FN2O/c1-15(25)24(20-6-4-19(22)5-7-20)21-8-10-23(11-9-21)14-18-13-16-2-3-17(18)12-16/h4-7,16-18,21H,2-3,8-14H2,1H3 |
| InChIKey | BIEJATDPNHTWSF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |