C24H31N3O2 — CID 1195032
[2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] propanoate (PubChem CID 1195032) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] propanoate.
| Compound Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 1195032 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccccc1-c1nc2ccccn2c1NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C24H31N3O2/c1-7-20(28)29-18-13-9-8-12-17(18)21-22(26-24(5,6)16-23(2,3)4)27-15-11-10-14-19(27)25-21/h8-15,26H,7,16H2,1-6H3 |
| InChIKey | PNFDJLGSZSORRS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|