C13H16Cl3N5O — CID 119504346
1-(2,6-dichlorophenyl)-5-methyl-N-[2-(methylamino)ethyl]-1,2,4-triazole-3-carboxamide;hydrochloride (PubChem CID 119504346) has the molecular formula C13H16Cl3N5O and a molecular weight of 364.66 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-methyl-N-[2-(methylamino)ethyl]-1,2,4-triazole-3-carboxamide;hydrochloride.
| Compound Name | 1-(2,6-dichlorophenyl)-5-methyl-N-[2-(methylamino)ethyl]-1,2,4-triazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119504346 |
| Molecular Formula | C13H16Cl3N5O |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-methyl-N-[2-(methylamino)ethyl]-1,2,4-triazole-3-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1nc(C)n(-c2c(Cl)cccc2Cl)n1.Cl |
| InChI | InChI=1S/C13H15Cl2N5O.ClH/c1-8-18-12(13(21)17-7-6-16-2)19-20(8)11-9(14)4-3-5-10(11)15;/h3-5,16H,6-7H2,1-2H3,(H,17,21);1H |
| InChIKey | YSPXHKHQKVQLJD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|