C16H22Cl3N5O — CID 119430439
1-(2,6-dichlorophenyl)-N-[3-(methylamino)propyl]-5-propan-2-yl-1,2,4-triazole-3-carboxamide;hydrochloride (PubChem CID 119430439) has the molecular formula C16H22Cl3N5O and a molecular weight of 406.75 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[3-(methylamino)propyl]-5-propan-2-yl-1,2,4-triazole-3-carboxamide;hydrochloride.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[3-(methylamino)propyl]-5-propan-2-yl-1,2,4-triazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119430439 |
| Molecular Formula | C16H22Cl3N5O |
| Molecular Weight | 406.75 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[3-(methylamino)propyl]-5-propan-2-yl-1,2,4-triazole-3-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)c1nc(C(C)C)n(-c2c(Cl)cccc2Cl)n1.Cl |
| InChI | InChI=1S/C16H21Cl2N5O.ClH/c1-10(2)15-21-14(16(24)20-9-5-8-19-3)22-23(15)13-11(17)6-4-7-12(13)18;/h4,6-7,10,19H,5,8-9H2,1-3H3,(H,20,24);1H |
| InChIKey | DOMUJJCCMXTVAF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.75 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|