C16H19BrN4O — CID 119504417
1-(3-bromophenyl)-N-[2-(methylamino)ethyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide (PubChem CID 119504417) has the molecular formula C16H19BrN4O and a molecular weight of 363.26 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[2-(methylamino)ethyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-[2-(methylamino)ethyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119504417 |
| Molecular Formula | C16H19BrN4O |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 1-(3-bromophenyl)-N-[2-(methylamino)ethyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
| SMILES | CNCCNC(=O)c1nn(-c2cccc(Br)c2)c2c1CCC2 |
| InChI | InChI=1S/C16H19BrN4O/c1-18-8-9-19-16(22)15-13-6-3-7-14(13)21(20-15)12-5-2-4-11(17)10-12/h2,4-5,10,18H,3,6-9H2,1H3,(H,19,22) |
| InChIKey | KPSLAQGTWKPFQV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|