C19H25BrN4O — CID 78886335
1-(3-bromophenyl)-N-[3-(dimethylamino)propyl]-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 78886335) has the molecular formula C19H25BrN4O and a molecular weight of 405.34 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[3-(dimethylamino)propyl]-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-[3-(dimethylamino)propyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 78886335 |
| Molecular Formula | C19H25BrN4O |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-(3-bromophenyl)-N-[3-(dimethylamino)propyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1nn(-c2cccc(Br)c2)c2c1CCCC2 |
| InChI | InChI=1S/C19H25BrN4O/c1-23(2)12-6-11-21-19(25)18-16-9-3-4-10-17(16)24(22-18)15-8-5-7-14(20)13-15/h5,7-8,13H,3-4,6,9-12H2,1-2H3,(H,21,25) |
| InChIKey | YZAKNXSGCJIRBT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|