C14H22Cl2N2O — CID 119504580
2-(4-chlorophenyl)-N-[2-(ethylamino)ethyl]-2-methylpropanamide;hydrochloride (PubChem CID 119504580) has the molecular formula C14H22Cl2N2O and a molecular weight of 305.25 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(ethylamino)ethyl]-2-methylpropanamide;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(ethylamino)ethyl]-2-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119504580 |
| Molecular Formula | C14H22Cl2N2O |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(ethylamino)ethyl]-2-methylpropanamide;hydrochloride |
| SMILES | CCNCCNC(=O)C(C)(C)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C14H21ClN2O.ClH/c1-4-16-9-10-17-13(18)14(2,3)11-5-7-12(15)8-6-11;/h5-8,16H,4,9-10H2,1-3H3,(H,17,18);1H |
| InChIKey | ABLMLOMMAVXLBS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|