C34H37N5O6S — CID 11950507
(3aR,6aS)-N-[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide (PubChem CID 11950507) has the molecular formula C34H37N5O6S and a molecular weight of 643.77 g/mol. Its IUPAC name is (3aR,6aS)-N-[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide.
| Compound Name | (3aR,6aS)-N-[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
|---|---|
| PubChem CID | 11950507 |
| Molecular Formula | C34H37N5O6S |
| Molecular Weight | 643.77 g/mol |
| Exact Mass | 643.25 |
| IUPAC Name | (3aR,6aS)-N-[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxamide |
| SMILES | CCc1cc2c(N3CCN(C(=O)c4ccc(-c5ccccc5)cc4)CC3)nc(NC(=O)C3OC(OC)[C@@H]4OC(C)(C)O[C@H]34)nc2s1 |
| InChI | InChI=1S/C34H37N5O6S/c1-5-23-19-24-28(38-15-17-39(18-16-38)31(41)22-13-11-21(12-14-22)20-9-7-6-8-10-20)35-33(37-30(24)46-23)36-29(40)26-25-27(32(42-4)43-26)45-34(2,3)44-25/h6-14,19,25-27,32H,5,15-18H2,1-4H3,(H,35,36,37,40)/t25-,26?,27-,32?/m1/s1 |
| InChIKey | VEOGZPQJFDGJMF-FHCXGBSGSA-N |
| XLogP | 4.71 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.77 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |