C29H32N6O3S — CID 11950686
1-[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]-3-(3-hydroxypropyl)urea (PubChem CID 11950686) has the molecular formula C29H32N6O3S and a molecular weight of 544.68 g/mol. Its IUPAC name is 1-[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 11950686 |
| Molecular Formula | C29H32N6O3S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 1-[6-ethyl-4-[4-(4-phenylbenzoyl)piperazin-1-yl]thieno[2,3-d]pyrimidin-2-yl]-3-(3-hydroxypropyl)urea |
| SMILES | CCc1cc2c(N3CCN(C(=O)c4ccc(-c5ccccc5)cc4)CC3)nc(NC(=O)NCCCO)nc2s1 |
| InChI | InChI=1S/C29H32N6O3S/c1-2-23-19-24-25(31-28(32-26(24)39-23)33-29(38)30-13-6-18-36)34-14-16-35(17-15-34)27(37)22-11-9-21(10-12-22)20-7-4-3-5-8-20/h3-5,7-12,19,36H,2,6,13-18H2,1H3,(H2,30,31,32,33,38) |
| InChIKey | QUVFAQNMSRZTFC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|