C26H28N6O2S — CID 143300611
[4-[2-(3-hydroxypropylamino)-6-methylthieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-(5-phenyl-2-pyridinyl)methanone (PubChem CID 143300611) has the molecular formula C26H28N6O2S and a molecular weight of 488.62 g/mol. Its IUPAC name is [4-[2-(3-hydroxypropylamino)-6-methylthieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-(5-phenyl-2-pyridinyl)methanone.
| Compound Name | [4-[2-(3-hydroxypropylamino)-6-methylthieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-(5-phenyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 143300611 |
| Molecular Formula | C26H28N6O2S |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | [4-[2-(3-hydroxypropylamino)-6-methylthieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-(5-phenyl-2-pyridinyl)methanone |
| SMILES | Cc1cc2c(N3CCN(C(=O)c4ccc(-c5ccccc5)cn4)CC3)nc(NCCCO)nc2s1 |
| InChI | InChI=1S/C26H28N6O2S/c1-18-16-21-23(29-26(27-10-5-15-33)30-24(21)35-18)31-11-13-32(14-12-31)25(34)22-9-8-20(17-28-22)19-6-3-2-4-7-19/h2-4,6-9,16-17,33H,5,10-15H2,1H3,(H,27,29,30) |
| InChIKey | PYAKCDFKWNOQJI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|