C10H15BrClN3O2 — CID 119508914
5-bromo-N-[2-(ethylamino)ethyl]-6-oxo-1H-pyridine-3-carboxamide;hydrochloride (PubChem CID 119508914) has the molecular formula C10H15BrClN3O2 and a molecular weight of 324.61 g/mol. Its IUPAC name is 5-bromo-N-[2-(ethylamino)ethyl]-6-oxo-1H-pyridine-3-carboxamide;hydrochloride.
| Compound Name | 5-bromo-N-[2-(ethylamino)ethyl]-6-oxo-1H-pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119508914 |
| Molecular Formula | C10H15BrClN3O2 |
| Molecular Weight | 324.61 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 5-bromo-N-[2-(ethylamino)ethyl]-6-oxo-1H-pyridine-3-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1c[nH]c(=O)c(Br)c1.Cl |
| InChI | InChI=1S/C10H14BrN3O2.ClH/c1-2-12-3-4-13-9(15)7-5-8(11)10(16)14-6-7;/h5-6,12H,2-4H2,1H3,(H,13,15)(H,14,16);1H |
| InChIKey | VWCIDWIWEQXVIZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.61 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|