C14H17BrN2O4 — CID 120544269
1-[[(5-bromo-6-oxo-1H-pyridine-3-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120544269) has the molecular formula C14H17BrN2O4 and a molecular weight of 357.20 g/mol. Its IUPAC name is 1-[[(5-bromo-6-oxo-1H-pyridine-3-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(5-bromo-6-oxo-1H-pyridine-3-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120544269 |
| Molecular Formula | C14H17BrN2O4 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 1-[[(5-bromo-6-oxo-1H-pyridine-3-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCCCC1)c1c[nH]c(=O)c(Br)c1 |
| InChI | InChI=1S/C14H17BrN2O4/c15-10-6-9(7-16-12(10)19)11(18)17-8-14(13(20)21)4-2-1-3-5-14/h6-7H,1-5,8H2,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | ODIQYRIFNFUNRF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |