About 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid
3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid (PubChem CID 11950905) has the molecular formula C21H26BrNO4S
and a molecular weight of 468.41 g/mol. Its IUPAC name is 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid |
| PubChem CID | 11950905 |
| Molecular Formula | C21H26BrNO4S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid |
| SMILES | Cc1cc(OC(CC(C)C)c2ccc(C(=O)NCCC(=O)O)s2)cc(C)c1Br |
| InChI | InChI=1S/C21H26BrNO4S/c1-12(2)9-16(27-15-10-13(3)20(22)14(4)11-15)17-5-6-18(28-17)21(26)23-8-7-19(24)25/h5-6,10-12,16H,7-9H2,1-4H3,(H,23,26)(H,24,25) |
| InChIKey | CITGBTPFGOEGNA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid?
The IUPAC name of 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid (CID 11950905) is 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid.
What is the SMILES notation for 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid?
The canonical SMILES for 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid is Cc1cc(OC(CC(C)C)c2ccc(C(=O)NCCC(=O)O)s2)cc(C)c1Br.
What is the InChIKey of 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid?
The InChIKey is CITGBTPFGOEGNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26BrNO4S/c1-12(2)9-16(27-15-10-13(3)20(22)14(4)11-15)17-5-6-18(28-17)21(26)23-8-7-19(24)25/h5-6,10-12,16H,7-9H2,1-4H3,(H,23,26)(H,24,25).
What are the key properties of 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid?
3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid has a molecular weight of 468.41 g/mol, XLogP of 5.50, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carbonyl]amino]propanoic acid is sourced from PubChem (CID 11950905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).