C10H17Cl2N5O — CID 119509819
3-amino-N-(pyrrolidin-2-ylmethyl)pyrazine-2-carboxamide;dihydrochloride (PubChem CID 119509819) has the molecular formula C10H17Cl2N5O and a molecular weight of 294.19 g/mol. Its IUPAC name is 3-amino-N-(pyrrolidin-2-ylmethyl)pyrazine-2-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-(pyrrolidin-2-ylmethyl)pyrazine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119509819 |
| Molecular Formula | C10H17Cl2N5O |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-amino-N-(pyrrolidin-2-ylmethyl)pyrazine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1nccnc1C(=O)NCC1CCCN1 |
| InChI | InChI=1S/C10H15N5O.2ClH/c11-9-8(13-4-5-14-9)10(16)15-6-7-2-1-3-12-7;;/h4-5,7,12H,1-3,6H2,(H2,11,14)(H,15,16);2*1H |
| InChIKey | DOYPYYDMRKJVDA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |