C10H17ClN4OS — CID 119510567
4-ethyl-N-(pyrrolidin-2-ylmethyl)thiadiazole-5-carboxamide;hydrochloride (PubChem CID 119510567) has the molecular formula C10H17ClN4OS and a molecular weight of 276.79 g/mol. Its IUPAC name is 4-ethyl-N-(pyrrolidin-2-ylmethyl)thiadiazole-5-carboxamide;hydrochloride.
| Compound Name | 4-ethyl-N-(pyrrolidin-2-ylmethyl)thiadiazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119510567 |
| Molecular Formula | C10H17ClN4OS |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-ethyl-N-(pyrrolidin-2-ylmethyl)thiadiazole-5-carboxamide;hydrochloride |
| SMILES | CCc1nnsc1C(=O)NCC1CCCN1.Cl |
| InChI | InChI=1S/C10H16N4OS.ClH/c1-2-8-9(16-14-13-8)10(15)12-6-7-4-3-5-11-7;/h7,11H,2-6H2,1H3,(H,12,15);1H |
| InChIKey | NSACKBQKCFKPIG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |