C9H14N4OS — CID 62541807
4-methyl-N-(pyrrolidin-2-ylmethyl)thiadiazole-5-carboxamide (PubChem CID 62541807) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-methyl-N-(pyrrolidin-2-ylmethyl)thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(pyrrolidin-2-ylmethyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 62541807 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4-methyl-N-(pyrrolidin-2-ylmethyl)thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NCC1CCCN1 |
| InChI | InChI=1S/C9H14N4OS/c1-6-8(15-13-12-6)9(14)11-5-7-3-2-4-10-7/h7,10H,2-5H2,1H3,(H,11,14) |
| InChIKey | OCBPLDYYHUTTQX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |