C14H21ClN4O5S — CID 119511611
2-[methyl-(3-nitrophenyl)sulfonylamino]-N-(pyrrolidin-2-ylmethyl)acetamide;hydrochloride (PubChem CID 119511611) has the molecular formula C14H21ClN4O5S and a molecular weight of 392.87 g/mol. Its IUPAC name is 2-[methyl-(3-nitrophenyl)sulfonylamino]-N-(pyrrolidin-2-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-[methyl-(3-nitrophenyl)sulfonylamino]-N-(pyrrolidin-2-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119511611 |
| Molecular Formula | C14H21ClN4O5S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[methyl-(3-nitrophenyl)sulfonylamino]-N-(pyrrolidin-2-ylmethyl)acetamide;hydrochloride |
| SMILES | CN(CC(=O)NCC1CCCN1)S(=O)(=O)c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C14H20N4O5S.ClH/c1-17(10-14(19)16-9-11-4-3-7-15-11)24(22,23)13-6-2-5-12(8-13)18(20)21;/h2,5-6,8,11,15H,3-4,7,9-10H2,1H3,(H,16,19);1H |
| InChIKey | PIPVLKSCQVJXMQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|