C15H22N4O5S — CID 119573617
N-(1-amino-2-cyclopropylpropan-2-yl)-2-[methyl-(3-nitrophenyl)sulfonylamino]acetamide (PubChem CID 119573617) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-2-[methyl-(3-nitrophenyl)sulfonylamino]acetamide.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2-[methyl-(3-nitrophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 119573617 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-2-[methyl-(3-nitrophenyl)sulfonylamino]acetamide |
| SMILES | CN(CC(=O)NC(C)(CN)C1CC1)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H22N4O5S/c1-15(10-16,11-6-7-11)17-14(20)9-18(2)25(23,24)13-5-3-4-12(8-13)19(21)22/h3-5,8,11H,6-7,9-10,16H2,1-2H3,(H,17,20) |
| InChIKey | ZJCGRUSHNXAEKS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|