C14H20N4O5S — CID 119378879
N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 119378879) has the molecular formula C14H20N4O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119378879 |
| Molecular Formula | C14H20N4O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CN(CC(=O)N1CCCC(N)C1)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H20N4O5S/c1-16(10-14(19)17-7-3-4-11(15)9-17)24(22,23)13-6-2-5-12(8-13)18(20)21/h2,5-6,8,11H,3-4,7,9-10,15H2,1H3 |
| InChIKey | GHTYFQJBYILBLC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|