C20H24F3N5O3 — CID 11951248
4-N-[(4-aminocyclohexyl)methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine (PubChem CID 11951248) has the molecular formula C20H24F3N5O3 and a molecular weight of 439.44 g/mol. Its IUPAC name is 4-N-[(4-aminocyclohexyl)methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine.
| Compound Name | 4-N-[(4-aminocyclohexyl)methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 11951248 |
| Molecular Formula | C20H24F3N5O3 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 4-N-[(4-aminocyclohexyl)methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine |
| SMILES | NC1CCC(CNc2cc(NCc3ccccc3OC(F)(F)F)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H24F3N5O3/c21-20(22,23)31-18-4-2-1-3-14(18)11-26-19-9-16(17(12-27-19)28(29)30)25-10-13-5-7-15(24)8-6-13/h1-4,9,12-13,15H,5-8,10-11,24H2,(H2,25,26,27) |
| InChIKey | JDSHFCRLMNYYSU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|