C23H21F3N8O2 — CID 11951533
1-[4-(6-aminopurin-9-yl)phenyl]-3-[4-pyrrolidin-3-yloxy-3-(trifluoromethyl)phenyl]urea (PubChem CID 11951533) has the molecular formula C23H21F3N8O2 and a molecular weight of 498.47 g/mol. Its IUPAC name is 1-[4-(6-aminopurin-9-yl)phenyl]-3-[4-pyrrolidin-3-yloxy-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(6-aminopurin-9-yl)phenyl]-3-[4-pyrrolidin-3-yloxy-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 11951533 |
| Molecular Formula | C23H21F3N8O2 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 1-[4-(6-aminopurin-9-yl)phenyl]-3-[4-pyrrolidin-3-yloxy-3-(trifluoromethyl)phenyl]urea |
| SMILES | Nc1ncnc2c1ncn2-c1ccc(NC(=O)Nc2ccc(OC3CCNC3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H21F3N8O2/c24-23(25,26)17-9-14(3-6-18(17)36-16-7-8-28-10-16)33-22(35)32-13-1-4-15(5-2-13)34-12-31-19-20(27)29-11-30-21(19)34/h1-6,9,11-12,16,28H,7-8,10H2,(H2,27,29,30)(H2,32,33,35) |
| InChIKey | VGSKPPMEDLGYTD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |