C18H23ClN4O3S — CID 119516416
N-(6-amino-3-pyridinyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide;hydrochloride (PubChem CID 119516416) has the molecular formula C18H23ClN4O3S and a molecular weight of 410.93 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119516416 |
| Molecular Formula | C18H23ClN4O3S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-4-methyl-3-piperidin-1-ylsulfonylbenzamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N)nc2)cc1S(=O)(=O)N1CCCCC1.Cl |
| InChI | InChI=1S/C18H22N4O3S.ClH/c1-13-5-6-14(18(23)21-15-7-8-17(19)20-12-15)11-16(13)26(24,25)22-9-3-2-4-10-22;/h5-8,11-12H,2-4,9-10H2,1H3,(H2,19,20)(H,21,23);1H |
| InChIKey | YUQRCGHXWPRIMJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |